Products 635702-60-2

CAS 635702-60-2 appears in our catalog under these names: Pazopanib Impurity 7 HCl, 2,3-Dimethyl-6-amino-2H-indazole Hydrochloride, >95% (HPLC), 2,3-Dimethyl-6-amino-2H-indazole Hydrochloride, 2,3–dimethyl–2H–indazol–6–amine hydrochloride, 2,3-Dimethyl-2H-indazol-6-amine hydrochloride 97%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 1g, 25g, 5g, 4x25mg, 25mg, 10g, 100g.

2,3-dimethylindazol-6-amine;hydrochloride (CAS 635702-60-2) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 2,3-dimethylindazol-6-amine;hydrochloride. InChIKey: DYTQJZDNKWQSLS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClN3
Molecular weight197.66 g/mol
IUPAC name2,3-dimethylindazol-6-amine;hydrochloride
InChIKeyDYTQJZDNKWQSLS-UHFFFAOYSA-N
SMILESCC1=C2C=CC(=CC2=NN1C)N.Cl

Computed by PubChem (NCBI)