CAS 63597-73-9 appears in our catalog under these names: cis-Dibromocypermethric acid 10 µg/mL in Methanol, cis-Dibromocypermethric acid 100 µg/mL in Acetonitrile, cis-Dibromocypermethric acid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1ml, 1x1ml.
Trans-(1S,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 63597-73-9) is a chemical compound with the molecular formula C8H10Br2O2 and a molecular weight of 297.97 g/mol. IUPAC name: trans-(1S,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: MDIQXIJPQWLFSD-INEUFUBQSA-N.
| Molecular formula | C8H10Br2O2 |
|---|---|
| Molecular weight | 297.97 g/mol |
| IUPAC name | trans-(1S,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | MDIQXIJPQWLFSD-INEUFUBQSA-N |
| SMILES | CC1([C@@H]([C@@H]1C(=O)O)C=C(Br)Br)C |
Computed by PubChem (NCBI)