CAS 63637-89-8 appears in our catalog under these names: Iprodione isomer 1, Iprodione Metabolite RP 30228. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 100mg, 1x100mg.
N-(3,5-dichlorophenyl)-2,4-dioxo-3-propan-2-ylimidazolidine-1-carboxamide (CAS 63637-89-8) is a chemical compound with the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.16 g/mol. IUPAC name: N-(3,5-dichlorophenyl)-2,4-dioxo-3-propan-2-ylimidazolidine-1-carboxamide. InChIKey: GKJUMTZXIUCPAG-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N3O3 |
|---|---|
| Molecular weight | 330.16 g/mol |
| IUPAC name | N-(3,5-dichlorophenyl)-2,4-dioxo-3-propan-2-ylimidazolidine-1-carboxamide |
| InChIKey | GKJUMTZXIUCPAG-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)CN(C1=O)C(=O)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)