Products 63656-27-9
CAS 63656-27-9 is the registry number for Methyl 2,4-dioxo-4-(4-phenylphenyl)butanoate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Methyl 2,4-dioxo-4-(4-phenylphenyl)butanoate (CAS 63656-27-9) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: methyl 2,4-dioxo-4-(4-phenylphenyl)butanoate. InChIKey: YDYQRPUOLGQGFI-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | methyl 2,4-dioxo-4-(4-phenylphenyl)butanoate |
| InChIKey | YDYQRPUOLGQGFI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
methyl 2,4-dioxo-4-(4-phenylphenyl)butanoate, methyl 4-(1,1'-biphenyl-4-yl)-2,4-dioxobutanoate, Methyl 4-([1,1'-biphenyl]-4-yl)-2,4-dioxobutanoate, methyl 4-{[1,1'-biphenyl]-4-yl}-2,4-dioxobutanoate, Methyl 4-(4-Biphenylyl)-2,4-dioxobutanoate, Methyl4-([1,1'-biphenyl]-4-yl)-2,4-dioxobutanoate