CAS 6367-17-5 appears in our catalog under these names: Ac–Trp–NHMe, Ac-Trp-NHMe. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 2g.
(2S)-2-acetamido-3-(1H-indol-3-yl)-N-methylpropanamide (CAS 6367-17-5) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: (2S)-2-acetamido-3-(1H-indol-3-yl)-N-methylpropanamide. InChIKey: DMEAHHGMZZKXFD-ZDUSSCGKSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(1H-indol-3-yl)-N-methylpropanamide |
| InChIKey | DMEAHHGMZZKXFD-ZDUSSCGKSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)NC |
Computed by PubChem (NCBI)