CAS 6383-69-3 appears in our catalog under these names: 2-Amino-3-(5-amino-1H-indol-3-yl)propanoic acid, ≥95%, ≥95%, 5-Amino-dl-tryptophan, 95%, 5-Amino-DL-tryptophan, 5-Amino-DL-tryptophan, 50 mg, 5-Amino-DL-tryptophan, 100 mg. Offered by: Chemat, Combi-blocks, Biosynth, Roth. Available pack sizes: 250mg, 100mg, 0,1g, 0,05g, 0,25g, 0,5g, 1g, 50mg.
2-amino-3-(5-amino-1H-indol-3-yl)propanoic acid (CAS 6383-69-3) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 2-amino-3-(5-amino-1H-indol-3-yl)propanoic acid. InChIKey: YNJSNEKCXVFDKW-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-amino-3-(5-amino-1H-indol-3-yl)propanoic acid |
| InChIKey | YNJSNEKCXVFDKW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)