CAS 6388-74-5 appears in our catalog under these names: 2-(4-Nitrophenyl)oxirane, 95%, 2–(4–Nitrophenyl)oxirane, 2-(4-Nitrophenyl)oxirane, 2-(4-Nitrophenyl)oxirane, >98.0%(GC), 2-(4-Nitrophenyl)oxirane, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 1g, 100mg, 2,5g, 250mg, 200mg, 10g.
2-(4-nitrophenyl)oxirane (CAS 6388-74-5) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-(4-nitrophenyl)oxirane. InChIKey: YKIUTLHCSNCTDZ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-(4-nitrophenyl)oxirane |
| InChIKey | YKIUTLHCSNCTDZ-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)