CAS 63911-32-0 appears in our catalog under these names: Convolidine, 95%, Convolidin. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 100mg, 50mg.
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 4-hydroxy-3-methoxybenzoate (CAS 63911-32-0) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 4-hydroxy-3-methoxybenzoate. InChIKey: GWWGRYGNRKFSSX-FOSCPWQOSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 4-hydroxy-3-methoxybenzoate |
| InChIKey | GWWGRYGNRKFSSX-FOSCPWQOSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC2C[C@H]3CC[C@@H](C2)N3)O |
Computed by PubChem (NCBI)