CAS 63929-86-2 is the registry number for 1-nitro-3-(pentyloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-nitro-3-pentoxybenzene (CAS 63929-86-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 1-nitro-3-pentoxybenzene. InChIKey: AQAMRMATJFGMAZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 1-nitro-3-pentoxybenzene |
| InChIKey | AQAMRMATJFGMAZ-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)