CAS 639810-40-5 is the registry number for 1-(4-(5-chloro-2-methylphenyl)piperazinyl)-2-(2-thienyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone (CAS 639810-40-5) is a chemical compound with the molecular formula C17H19ClN2OS and a molecular weight of 334.9 g/mol. IUPAC name: 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone. InChIKey: LIFZMYSEOZZMRJ-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2OS |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone |
| InChIKey | LIFZMYSEOZZMRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)CC3=CC=CS3 |
Computed by PubChem (NCBI)