Products 640-60-8
CAS 640-60-8 appears in our catalog under these names: Phenyl Tosylate, >95% (HPLC), Phenyl p–Toluenesulfonate, Phenyl p-Toluenesulfonate, >99.0%(GC), Phenyl p-Toluenesulfonate 99%, Phenyl p-Toluenesulfonate, 99%, 99%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 100g, 500g.
Phenyl 4-methylbenzenesulfonate (CAS 640-60-8) is a chemical compound with the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. IUPAC name: phenyl 4-methylbenzenesulfonate. InChIKey: KZQFPRKQBWRRHQ-UHFFFAOYSA-N.
| Molecular formula | C13H12O3S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | phenyl 4-methylbenzenesulfonate |
| InChIKey | KZQFPRKQBWRRHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)