CAS 64035-45-6 is the registry number for Methyl 6-(Chloromethyl)-3-methyl-4-phenylpicolinate. Offered by: TRC. Available pack sizes: 100mg.
Methyl 6-(chloromethyl)-3-methyl-4-phenylpyridine-2-carboxylate (CAS 64035-45-6) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: methyl 6-(chloromethyl)-3-methyl-4-phenylpyridine-2-carboxylate. InChIKey: CVSKQIKCDVJBKD-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | methyl 6-(chloromethyl)-3-methyl-4-phenylpyridine-2-carboxylate |
| InChIKey | CVSKQIKCDVJBKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N=C1C(=O)OC)CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)