Products 6406-91-3
CAS 6406-91-3 is the registry number for 3-​Methyl-benzo(b)​thiophene 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-methyl-1-benzothiophene 1,1-dioxide (CAS 6406-91-3) is a chemical compound with the molecular formula C9H8O2S and a molecular weight of 180.23 g/mol. IUPAC name: 3-methyl-1-benzothiophene 1,1-dioxide. InChIKey: DCAZNDCIMXHKOS-UHFFFAOYSA-N.
| Molecular formula | C9H8O2S |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | 3-methyl-1-benzothiophene 1,1-dioxide |
| InChIKey | DCAZNDCIMXHKOS-UHFFFAOYSA-N |
| SMILES | CC1=CS(=O)(=O)C2=CC=CC=C12 |
Computed by PubChem (NCBI)
Synonyms:
3-methyl-1lambda6-benzothiophene-1,1-dione, Benzo(b)thiophene 1,1-dioxide, 3-methyl-, Benzo[b]thiophene 1,1-dioxide, 3-methyl-, 3-Methylbenzothiophene 1,1-dioxide, 3-Methylbenzo[b]thiophene 1,1-dioxide, 3-Methyl-1-benzothiophene 1,1-dioxide, 3-Methylbenzo[b]thiophene dioxide, 3-Methyl-benzo(b)thiophene-1,1-dioxide, Benzo[b]thiophene, 3-methyl-, 1,1-dioxide, DCAZNDCIMXHKOS-UHFFFAOYSA-N