CAS 640767-54-0 appears in our catalog under these names: 2-Isobutoxy-4-methyl-1-nitrobenzene, 95%, 2–isobutoxy–4–methyl–1–nitrobenzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-methyl-2-(2-methylpropoxy)-1-nitrobenzene (CAS 640767-54-0) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 4-methyl-2-(2-methylpropoxy)-1-nitrobenzene. InChIKey: FEHPWJCEHZPRQF-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-methyl-2-(2-methylpropoxy)-1-nitrobenzene |
| InChIKey | FEHPWJCEHZPRQF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])OCC(C)C |
Computed by PubChem (NCBI)