Products 642411-11-8
CAS 642411-11-8 appears in our catalog under these names: Diethyl 1-benzylazetidine-3,3-dicarboxylate, 97%, Diethyl 1-benzylazetidine-3,3-dicarboxylate, 95%, 95%, Diethyl 1-Benzylazetidine-3,3-Dicarboxylate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100g.
Diethyl 1-benzylazetidine-3,3-dicarboxylate (CAS 642411-11-8) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: diethyl 1-benzylazetidine-3,3-dicarboxylate. InChIKey: KGNAKGKJEBUHRV-UHFFFAOYSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | diethyl 1-benzylazetidine-3,3-dicarboxylate |
| InChIKey | KGNAKGKJEBUHRV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)CC2=CC=CC=C2)C(=O)OCC |
Computed by PubChem (NCBI)