Products 642437-08-9

CAS 642437-08-9 is the registry number for 3-[Benzyl(methyl)carbamoyl]prop-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(E)-4-[benzyl(methyl)amino]-4-oxobut-2-enoic acid (CAS 642437-08-9) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: (E)-4-[benzyl(methyl)amino]-4-oxobut-2-enoic acid. InChIKey: LFWYJFPYELUEKZ-BQYQJAHWSA-N.

Identity
Molecular formulaC12H13NO3
Molecular weight219.24 g/mol
IUPAC name(E)-4-[benzyl(methyl)amino]-4-oxobut-2-enoic acid
InChIKeyLFWYJFPYELUEKZ-BQYQJAHWSA-N
SMILESCN(CC1=CC=CC=C1)C(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)