Products 643-37-8
CAS 643-37-8 is the registry number for 6,8-Dibromoquinazoline-2,4(1H,3H)-dione, 95+%. Offered by: Chemat. Available pack sizes: 1g.
6,8-dibromo-1H-quinazoline-2,4-dione (CAS 643-37-8) is a chemical compound with the molecular formula C8H4Br2N2O2 and a molecular weight of 319.94 g/mol. IUPAC name: 6,8-dibromo-1H-quinazoline-2,4-dione. InChIKey: ZIXYTRRIMYQCPB-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2O2 |
|---|---|
| Molecular weight | 319.94 g/mol |
| IUPAC name | 6,8-dibromo-1H-quinazoline-2,4-dione |
| InChIKey | ZIXYTRRIMYQCPB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)NC(=O)N2)Br)Br |
Computed by PubChem (NCBI)