CAS 643087-28-9 is the registry number for Methyl 2-methyl-1-oxo-1,2,3,4-tetrahydroisoquinoline-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-methyl-1-oxo-3,4-dihydroisoquinoline-6-carboxylate (CAS 643087-28-9) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: methyl 2-methyl-1-oxo-3,4-dihydroisoquinoline-6-carboxylate. InChIKey: OHJUFORFXOSEHF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | methyl 2-methyl-1-oxo-3,4-dihydroisoquinoline-6-carboxylate |
| InChIKey | OHJUFORFXOSEHF-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1=O)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)