CAS 64314-16-5 appears in our catalog under these names: (+)-Anatoxin A Hydrochloride, >95% (HPLC), (+)-Anatoxin A hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 2,5mg, 5mg, 1mg, 2mg.
1-[(1S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone;hydrochloride (CAS 64314-16-5) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: 1-[(1S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone;hydrochloride. InChIKey: ZYFLQFXDHYWQMQ-LQRGNCEWSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | 1-[(1S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone;hydrochloride |
| InChIKey | ZYFLQFXDHYWQMQ-LQRGNCEWSA-N |
| SMILES | CC(=O)C1=CCCC2CC[C@@H]1N2.Cl |
Computed by PubChem (NCBI)