CAS 92216-03-0 is the registry number for (-)-Anatoxin-alpha Hydrochloride. Offered by: TRC. Available pack sizes: 75mg.
1-[(1S,6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone;hydrochloride (CAS 92216-03-0) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: 1-[(1S,6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone;hydrochloride. InChIKey: ZYFLQFXDHYWQMQ-GNAZCLTHSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | 1-[(1S,6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone;hydrochloride |
| InChIKey | ZYFLQFXDHYWQMQ-GNAZCLTHSA-N |
| SMILES | CC(=O)C1=CCC[C@H]2CC[C@@H]1N2.Cl |
Computed by PubChem (NCBI)