CAS 64404-51-9 appears in our catalog under these names: 5,7-Dimethoxysaccharine, 95%, 95%, 5,7-Dimethoxybenzo[d]isothiazol-3(2H)-one 1,1-dioxide, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
5,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one (CAS 64404-51-9) is a chemical compound with the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. IUPAC name: 5,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: RMIMOFZZDXCGRA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5S |
|---|---|
| Molecular weight | 243.24 g/mol |
| IUPAC name | 5,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | RMIMOFZZDXCGRA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)