Products 6443-79-4
CAS 6443-79-4 is the registry number for 2,5-Diphenylpenta-2,4-dienenitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2E,4E)-2,5-diphenylpenta-2,4-dienenitrile (CAS 6443-79-4) is a chemical compound with the molecular formula C17H13N and a molecular weight of 231.29 g/mol. IUPAC name: (2E,4E)-2,5-diphenylpenta-2,4-dienenitrile. InChIKey: MEAXDVRKAWCVJF-DESBJYGPSA-N.
| Molecular formula | C17H13N |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2E,4E)-2,5-diphenylpenta-2,4-dienenitrile |
| InChIKey | MEAXDVRKAWCVJF-DESBJYGPSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C(/C#N)\C2=CC=CC=C2 |
Computed by PubChem (NCBI)