Products 64495-92-7
CAS 64495-92-7 is the registry number for 5,5-dimethyl-2-(((3-nitrophenyl)amino)methylene)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 500mg.
3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)iminomethyl]cyclohex-2-en-1-one (CAS 64495-92-7) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: 3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)iminomethyl]cyclohex-2-en-1-one. InChIKey: VOFHNXTWBFDPMY-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 3-hydroxy-5,5-dimethyl-2-[(3-nitrophenyl)iminomethyl]cyclohex-2-en-1-one |
| InChIKey | VOFHNXTWBFDPMY-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C=NC2=CC(=CC=C2)[N+](=O)[O-])O)C |
Computed by PubChem (NCBI)