Products 6453-58-3

CAS 6453-58-3 is the registry number for 5-[[Amino(imino)methyl]amino]-2-(benzoylamino)pentanoic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-benzamido-5-(diaminomethylideneamino)pentanoic acid (CAS 6453-58-3) is a chemical compound with the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. IUPAC name: 2-benzamido-5-(diaminomethylideneamino)pentanoic acid. InChIKey: RSYYQCDERUOEFI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N4O3
Molecular weight278.31 g/mol
IUPAC name2-benzamido-5-(diaminomethylideneamino)pentanoic acid
InChIKeyRSYYQCDERUOEFI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)NC(CCCN=C(N)N)C(=O)O

Computed by PubChem (NCBI)