CAS 6455-31-8 appears in our catalog under these names: 5-Phenylisoxazol-3-amine, 95+%, 5-Phenylisoxazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 100mg, 0,5g.
5-phenyl-1,2-oxazol-3-amine (CAS 6455-31-8) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-phenyl-1,2-oxazol-3-amine. InChIKey: YZEWHEPWBIADPY-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazol-3-amine |
| InChIKey | YZEWHEPWBIADPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)N |
Computed by PubChem (NCBI)