CAS 64635-54-7 appears in our catalog under these names: 3-Ethoxy-4-nitrophenol, 95%, 3-Ethoxy-4-nitrophenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-ethoxy-4-nitrophenol (CAS 64635-54-7) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 3-ethoxy-4-nitrophenol. InChIKey: ZUNWONPKZLVYCJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3-ethoxy-4-nitrophenol |
| InChIKey | ZUNWONPKZLVYCJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)