CAS 64654-10-0 is the registry number for 1,3-Benzodioxol-5-yl-1-pyrrolidinyl-methanone. Offered by: TRC. Available pack sizes: 500mg.
1,3-benzodioxol-5-yl(pyrrolidin-1-yl)methanone (CAS 64654-10-0) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 1,3-benzodioxol-5-yl(pyrrolidin-1-yl)methanone. InChIKey: OHNMXDCVKSTQQF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl(pyrrolidin-1-yl)methanone |
| InChIKey | OHNMXDCVKSTQQF-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)