CAS 64704-12-7 is the registry number for Propan-2-yl 3-Nitro Benzenesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 3-nitrobenzenesulfonate (CAS 64704-12-7) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: propan-2-yl 3-nitrobenzenesulfonate. InChIKey: QJLJNGISHZEJKJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | propan-2-yl 3-nitrobenzenesulfonate |
| InChIKey | QJLJNGISHZEJKJ-UHFFFAOYSA-N |
| SMILES | CC(C)OS(=O)(=O)C1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)