Products 64724-23-8
CAS 64724-23-8 appears in our catalog under these names: 2-Amino-5-chloro-3-iodobenzoic acid, 97%, 97%, 2-Amino-5-chloro-3-iodobenzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g.
2-amino-5-chloro-3-iodobenzoic acid (CAS 64724-23-8) is a chemical compound with the molecular formula C7H5ClINO2 and a molecular weight of 297.48 g/mol. IUPAC name: 2-amino-5-chloro-3-iodobenzoic acid. InChIKey: VJRDUSOUTARJDM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClINO2 |
|---|---|
| Molecular weight | 297.48 g/mol |
| IUPAC name | 2-amino-5-chloro-3-iodobenzoic acid |
| InChIKey | VJRDUSOUTARJDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)I)Cl |
Computed by PubChem (NCBI)