CAS 64732-35-0 appears in our catalog under these names: (4-Ethylphenyl)methanesulfonamide, 97%, (4-Ethylphenyl)methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4-ethylphenyl)methanesulfonamide (CAS 64732-35-0) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: (4-ethylphenyl)methanesulfonamide. InChIKey: OROKGWLRAPYCDG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | (4-ethylphenyl)methanesulfonamide |
| InChIKey | OROKGWLRAPYCDG-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)CS(=O)(=O)N |
Computed by PubChem (NCBI)