Products 64840-18-2

CAS 64840-18-2 is the registry number for 2-(((Benzyloxy)carbonyl)amino)-3-hydroxy-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-hydroxy-2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 64840-18-2) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: 3-hydroxy-2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: QPGOJGJGAWHTFS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO5
Molecular weight253.25 g/mol
IUPAC name3-hydroxy-2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid
InChIKeyQPGOJGJGAWHTFS-UHFFFAOYSA-N
SMILESCC(CO)(C(=O)O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)