Products 64925-81-1

CAS 64925-81-1 is the registry number for Phomopsin B. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

Ethyl 2-(11-hydroxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydro-1-benzoxecin-9-yl)acetate (CAS 64925-81-1) is a chemical compound with the molecular formula C18H24O5 and a molecular weight of 320.4 g/mol. IUPAC name: ethyl 2-(11-hydroxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydro-1-benzoxecin-9-yl)acetate. InChIKey: NAIZDAPNTYQVEE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24O5
Molecular weight320.4 g/mol
IUPAC nameethyl 2-(11-hydroxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydro-1-benzoxecin-9-yl)acetate
InChIKeyNAIZDAPNTYQVEE-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=C2C(=O)CCCCCC(OC2=CC(=C1)O)C

Computed by PubChem (NCBI)

Synonyms: Phomopsin B