CAS 652993-86-7 appears in our catalog under these names: 6,8-Dimethoxy-2-methylquinolin-4(1H)-one, 98%, 6,8-Dimethoxy-2-methyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 1g.
6,8-dimethoxy-2-methyl-1H-quinolin-4-one (CAS 652993-86-7) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 6,8-dimethoxy-2-methyl-1H-quinolin-4-one. InChIKey: HSWLTMTZQPZCEO-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 6,8-dimethoxy-2-methyl-1H-quinolin-4-one |
| InChIKey | HSWLTMTZQPZCEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=CC(=C2)OC)OC |
Computed by PubChem (NCBI)