CAS 652997-67-6 appears in our catalog under these names: Ethyl (E)-3-(4-cyano-2-nitrophenyl)acrylate, 95%, (E)–Ethyl 3–(4–Cyano–2–Nitrophenyl)Acrylate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
Ethyl (E)-3-(4-cyano-2-nitrophenyl)prop-2-enoate (CAS 652997-67-6) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: ethyl (E)-3-(4-cyano-2-nitrophenyl)prop-2-enoate. InChIKey: WMFKQJPKYJSLNX-AATRIKPKSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | ethyl (E)-3-(4-cyano-2-nitrophenyl)prop-2-enoate |
| InChIKey | WMFKQJPKYJSLNX-AATRIKPKSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=C(C=C1)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)