Products 653-15-6
CAS 653-15-6 appears in our catalog under these names: 1-(2,5-Difluorophenyl)-2,2-difluoroethan-1-one, 95%, 1-(2,5-Difluorophenyl)-2,2-difluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,5-difluorophenyl)-2,2-difluoroethanone (CAS 653-15-6) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 1-(2,5-difluorophenyl)-2,2-difluoroethanone. InChIKey: UXFHPIWNFUQEJS-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)-2,2-difluoroethanone |
| InChIKey | UXFHPIWNFUQEJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)C(F)F)F |
Computed by PubChem (NCBI)