Products 65321-36-0
CAS 65321-36-0 appears in our catalog under these names: tert-Butyl nicotinate, 98%, tert-Butyl pyridine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 2,5g, 250mg.
Tert-butyl pyridine-3-carboxylate (CAS 65321-36-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: tert-butyl pyridine-3-carboxylate. InChIKey: JYEVUDXCQHLXNG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | tert-butyl pyridine-3-carboxylate |
| InChIKey | JYEVUDXCQHLXNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
Tert-butyl Pyridine-3-carboxylate, 3-Pyridinecarboxylic acid, 1,1-dimethylethyl ester, tert-butyl nicotinate, pyridine-3-carboxylic acid tert-butyl ester, nicotinic acid tert-butyl ester, tert-butylnicotinate, JYEVUDXCQHLXNG-UHFFFAOYSA-N, 1,1-Dimethylethyl 3-pyridinecarboxylate, Tert-butyl pyridine-3-carboxylate_x000D_