Products 65322-89-6
CAS 65322-89-6 appears in our catalog under these names: Bestatin Methyl Ester, >95% (HPLC), Bestatin methyl ester, 98%, Bestatin methyl ester, 95.0%. Offered by: TRC, AmBeed, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 1g, 5 mg, 50 mg, 25 mg.
Methyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate (CAS 65322-89-6) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: methyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate. InChIKey: WGNKTWBIPBOGLO-ILXRZTDVSA-N.
| Molecular formula | C17H26N2O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate |
| InChIKey | WGNKTWBIPBOGLO-ILXRZTDVSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)N)O |
Computed by PubChem (NCBI)