Products 65555-88-6
CAS 65555-88-6 appears in our catalog under these names: Methyldopa EP Impurity B, (S)-2-Amino-3-(4-methoxyphenyl)-2-methylpropanoic acid, 98%, (S)–2–Amino–3–(4–methoxyphenyl)–2–methylpropanoic acid, (2S)-2-Amino-3-(4-methoxyphenyl)-2-methylpropanoic acid. Offered by: Chemat Brand, AmBeed, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 500mg, 100mg, 50mg, 1000mg.
(2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid (CAS 65555-88-6) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid. InChIKey: GSEIHXWCWAMTTH-NSHDSACASA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid |
| InChIKey | GSEIHXWCWAMTTH-NSHDSACASA-N |
| SMILES | C[C@](CC1=CC=C(C=C1)OC)(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
O,alpha-dimethyl-L-tyrosine, (2S)-2-Amino-3-(4-methoxyphenyl)-2-methylpropanoic acid, L-Tyrosine, O,alpha-dimethyl-, Methyldopa specified impurity B [EP], O-METHYL METYROSINE, O,.ALPHA.-DIMETHYL-L-TYROSINE, L-TYROSINE, O,.ALPHA.-DIMETHYL-, METHYLDOPA IMPURITY B [EP IMPURITY], METHYLDOPA IMPURITY B (EP IMPURITY), Methyldopa specified impurity B