CAS 65621-26-3 appears in our catalog under these names: (S)–2,3–Bis(((benzyloxy)carbonyl)amino)propanoic acid, Cbz-Dap(Cbz)-OH 97%, Z-DAP(Z)-OH, 97%, 97%, Na,b-Bis-Z-L-2,3-diaminopropionic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2S)-2,3-bis(phenylmethoxycarbonylamino)propanoic acid (CAS 65621-26-3) is a chemical compound with the molecular formula C19H20N2O6 and a molecular weight of 372.4 g/mol. IUPAC name: (2S)-2,3-bis(phenylmethoxycarbonylamino)propanoic acid. InChIKey: YTQKWTMXEWAKAJ-INIZCTEOSA-N.
| Molecular formula | C19H20N2O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (2S)-2,3-bis(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | YTQKWTMXEWAKAJ-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)