Products 7801-35-6
CAS 7801-35-6 is the registry number for Z-Gly-Tyr-OH. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
(2S)-3-(4-hydroxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoic acid (CAS 7801-35-6) is a chemical compound with the molecular formula C19H20N2O6 and a molecular weight of 372.4 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoic acid. InChIKey: YYPNBRMRXNXSDE-INIZCTEOSA-N.
| Molecular formula | C19H20N2O6 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoic acid |
| InChIKey | YYPNBRMRXNXSDE-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)