CAS 6563-11-7 appears in our catalog under these names: 6-Bromoquinoline 1-oxide, 95%, 6–bromo–1–oxido–quinoline, 6-Bromoquinoline 1-oxide, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 1g, 250mg, 100mg.
6-bromo-1-oxidoquinolin-1-ium (CAS 6563-11-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 6-bromo-1-oxidoquinolin-1-ium. InChIKey: PSZUKCUBGTVVPJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 6-bromo-1-oxidoquinolin-1-ium |
| InChIKey | PSZUKCUBGTVVPJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)[N+](=C1)[O-] |
Computed by PubChem (NCBI)