Products 65714-27-4
CAS 65714-27-4 appears in our catalog under these names: 8-Methylquinoline-2-carboxylic acid, 8-Methylquinoline-2-carboxylic Acid, >97%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
8-methylquinoline-2-carboxylic acid (CAS 65714-27-4) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 8-methylquinoline-2-carboxylic acid. InChIKey: NVWDRVVQHUVVER-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 8-methylquinoline-2-carboxylic acid |
| InChIKey | NVWDRVVQHUVVER-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)