CAS 6575-24-2 appears in our catalog under these names: 2,6-Dichlorophenylacetic Acid, 2,6-Dichlorophenylacetic Acid, >95% (HPLC), 2,6–Dichlorophenylacetic acid, 2,6-Dichlorophenylacetic acid/ 99%, 2,6-Dichlorophenylacetic acid, 98% . Offered by: Chemat Brand, TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 100g, 10g, 25g, 500g, 5g, 250g, 1000g.
2-(2,6-dichlorophenyl)acetic acid (CAS 6575-24-2) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)acetic acid. InChIKey: SFAILOOQFZNOAU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)acetic acid |
| InChIKey | SFAILOOQFZNOAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)O)Cl |
Computed by PubChem (NCBI)