CAS 65807-08-1 appears in our catalog under these names: N-Nitroso-D,L-proline-d3, >95% (HPLC), N-Nitroso-DL-proline-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2,5,5-trideuterio-1-nitrosopyrrolidine-2-carboxylic acid (CAS 65807-08-1) is a chemical compound with the molecular formula C5H8N2O3 and a molecular weight of 147.15 g/mol. IUPAC name: 2,5,5-trideuterio-1-nitrosopyrrolidine-2-carboxylic acid. InChIKey: WLKPHJWEIIAIFW-FBYXXYQPSA-N.
| Molecular formula | C5H8N2O3 |
|---|---|
| Molecular weight | 147.15 g/mol |
| IUPAC name | 2,5,5-trideuterio-1-nitrosopyrrolidine-2-carboxylic acid |
| InChIKey | WLKPHJWEIIAIFW-FBYXXYQPSA-N |
| SMILES | [2H]C1(CCC(N1N=O)([2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)