CAS 65854-97-9 appears in our catalog under these names: Phenytoin-d10, 5,5-(Diphenyl-d10) Hydantoin, >95% (HPLC), 5,5-Diphenyl-d10-hydantoin, 99 atom % D, min 98% Chemical Purity, Phenytoin–d10, Phenytoin-d10, 99.50%. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 10mg, 1mg, 5mg, 0,05g, 10 mg, 1x10mg.
5,5-bis(2,3,4,5,6-pentadeuteriophenyl)imidazolidine-2,4-dione (CAS 65854-97-9) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 262.33 g/mol. IUPAC name: 5,5-bis(2,3,4,5,6-pentadeuteriophenyl)imidazolidine-2,4-dione. InChIKey: CXOFVDLJLONNDW-LHNTUAQVSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 5,5-bis(2,3,4,5,6-pentadeuteriophenyl)imidazolidine-2,4-dione |
| InChIKey | CXOFVDLJLONNDW-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C(=O)NC(=O)N2)C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)