Products 78213-26-0
CAS 78213-26-0 is the registry number for Phenytoin-15N2,13C, 99.84%. Offered by: MedChemExpress. Available pack sizes: 120 μg (391.77 μM * 1.2 mL in Methanol).
5,5-diphenyl-(213C,1,3-15N2)1,3-diazolidine-2,4-dione (CAS 78213-26-0) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 255.25 g/mol. IUPAC name: 5,5-diphenyl-(213C,1,3-15N2)1,3-diazolidine-2,4-dione. InChIKey: CXOFVDLJLONNDW-JDOJCZCPSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 5,5-diphenyl-(213C,1,3-15N2)1,3-diazolidine-2,4-dione |
| InChIKey | CXOFVDLJLONNDW-JDOJCZCPSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)[15NH][13C](=O)[15NH]2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)