Products 658683-23-9

CAS 658683-23-9 appears in our catalog under these names: 2–(1–((tert–Butoxycarbonyl)amino)ethyl)benzoic acid, 2-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid (CAS 658683-23-9) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid. InChIKey: DKYNPOSKMRUQJI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO4
Molecular weight265.30 g/mol
IUPAC name2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid
InChIKeyDKYNPOSKMRUQJI-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)