Products 65907-12-2

CAS 65907-12-2 is the registry number for 5-Acetylnicotinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-acetylpyridine-3-carboxylic acid (CAS 65907-12-2) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 5-acetylpyridine-3-carboxylic acid. InChIKey: RQMHGAMGCAYIGM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO3
Molecular weight165.15 g/mol
IUPAC name5-acetylpyridine-3-carboxylic acid
InChIKeyRQMHGAMGCAYIGM-UHFFFAOYSA-N
SMILESCC(=O)C1=CC(=CN=C1)C(=O)O

Computed by PubChem (NCBI)