CAS 65907-12-2 is the registry number for 5-Acetylnicotinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-acetylpyridine-3-carboxylic acid (CAS 65907-12-2) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 5-acetylpyridine-3-carboxylic acid. InChIKey: RQMHGAMGCAYIGM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 5-acetylpyridine-3-carboxylic acid |
| InChIKey | RQMHGAMGCAYIGM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CN=C1)C(=O)O |
Computed by PubChem (NCBI)