Products 65907-76-8
CAS 65907-76-8 appears in our catalog under these names: Danshenxinkun B, Danshenxinkun B, 99.89%, Danshenxinkun B, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione (CAS 65907-76-8) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: 1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione. InChIKey: PVIJIAVGFMTLEI-UHFFFAOYSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione |
| InChIKey | PVIJIAVGFMTLEI-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C(=C3O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Danshenxinkun B, 1-hydroxy-8-methyl-2-propan-2-ylphenanthrene-3,4-dione, 3-Hydroxy-2-isopropyl-8-methylphenanthrene-1,4-dione, Danshexinkun B, 3-Hydroxy-2-isopropyl-8-methyl-1,4-phenanthrenedione, orb1684664, Tanshinone Impurity 4; Danshenxinkun B, 1-Hydroxy-8-methyl-2-(propan-2-yl)phenanthrene-3,4-dione