CAS 65907-77-9 appears in our catalog under these names: Tanshinone Impurity 5, Danshenxinkun C, Danshenxinkun C. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 10mg, 50mg, Get quote.
1-hydroxy-2,8-dimethylphenanthrene-3,4-dione (CAS 65907-77-9) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 1-hydroxy-2,8-dimethylphenanthrene-3,4-dione. InChIKey: XUULFFYQZPYLEM-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 1-hydroxy-2,8-dimethylphenanthrene-3,4-dione |
| InChIKey | XUULFFYQZPYLEM-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C(=C3O)C |
Computed by PubChem (NCBI)